| Name |
3-(2,4-Dioxohexahydropyrimidin-1-yl)-4-(1,2,4-triazol-4-yl)benzoic acid
|
| Molecular Formula |
C13H11N5O4
|
| Molecular Weight |
301.26
|
| Smiles |
O=C1CCN(c2cc(C(=O)O)ccc2-n2cnnc2)C(=O)N1
|
O=C1CCN(c2cc(C(=O)O)ccc2-n2cnnc2)C(=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.