| Name |
ethyl (2E)-3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-2,3-dihydro-1H-isoindol-5-yl]prop-2-enoate
|
| Molecular Formula |
C18H16N2O6
|
| Molecular Weight |
356.3
|
| Smiles |
CCOC(=O)C=Cc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O
|
CCOC(=O)C=Cc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.