| Name |
methyl 6-({[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxo-2,3-dihydro-1H-isoindol-5-yl]amino}methyl)-1H,2H,3H,4H-pyrrolo[1,2-a]pyrazine-8-carboxylate
|
| Molecular Formula |
C23H23N5O6
|
| Molecular Weight |
465.5
|
| Smiles |
COC(=O)c1cc(CNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)n2c1CNCC2
|
COC(=O)c1cc(CNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)n2c1CNCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.