| Name |
2-{7-sulfanyl-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl}propane-1,3-diol
|
| Molecular Formula |
C7H9N5O2S
|
| Molecular Weight |
227.25
|
| Smiles |
OCC(CO)n1nnc2c(=S)nc[nH]c21
|
OCC(CO)n1nnc2c(=S)nc[nH]c21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.