| Name |
5-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) 3-methyl 1-phenyl-1H-pyrazole-3,5-dicarboxylate
|
| Molecular Formula |
C20H13N3O6
|
| Molecular Weight |
391.3
|
| Smiles |
COC(=O)c1cc(C(=O)ON2C(=O)c3ccccc3C2=O)n(-c2ccccc2)n1
|
COC(=O)c1cc(C(=O)ON2C(=O)c3ccccc3C2=O)n(-c2ccccc2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.