| Name |
benzyl 3-chloro-5H,6H,7H,8H-imidazo[1,2-a]pyrazine-7-carboxylate
|
| Molecular Formula |
C14H14ClN3O2
|
| Molecular Weight |
291.73
|
| Smiles |
O=C(OCc1ccccc1)N1CCn2c(Cl)cnc2C1
|
O=C(OCc1ccccc1)N1CCn2c(Cl)cnc2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.