| Name |
benzyl N-{5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxo-1,2-dihydropyrimidin-4-yl}carbamate
|
| Molecular Formula |
C16H16FN3O5S
|
| Molecular Weight |
381.4
|
| Smiles |
O=C(Nc1nc(=O)n(C2CSC(CO)O2)cc1F)OCc1ccccc1
|
O=C(Nc1nc(=O)n(C2CSC(CO)O2)cc1F)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.