| Name |
4-(Oxolan-2-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid
|
| Molecular Formula |
C12H14N2O5S
|
| Molecular Weight |
298.32
|
| Smiles |
C=CCOC(=O)Nc1nc(C2CCCO2)c(C(=O)O)s1
|
C=CCOC(=O)Nc1nc(C2CCCO2)c(C(=O)O)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.