| Name |
5-(2,2,3-Trimethylbutyl)-1,2,3,6-tetrahydropyridin-3-ol
|
| Molecular Formula |
C12H23NO
|
| Molecular Weight |
197.32
|
| Smiles |
CC(C)C(C)(C)CC1=CC(O)CNC1
|
CC(C)C(C)(C)CC1=CC(O)CNC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.