| Name |
Methyl 20-Dihydro Fluocinolone Acetonide 21-oate
|
| Molecular Formula |
C25H32F2O7
|
| Molecular Weight |
482.5
|
| Smiles |
COC(=O)C(O)C12OC(C)(C)OC1CC1C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC12C
|
COC(=O)C(O)C12OC(C)(C)OC1CC1C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC12C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.