| Name |
2-(trichloromethyl)-5H,6H,7H,8H-pyrido[3,4-d]pyrimidine
|
| Molecular Formula |
C8H8Cl3N3
|
| Molecular Weight |
252.5
|
| Smiles |
ClC(Cl)(Cl)c1ncc2c(n1)CNCC2
|
ClC(Cl)(Cl)c1ncc2c(n1)CNCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.