| Name |
2-[3-({[5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,2-oxazol-3-yl]formamido}methyl)cyclobutyl]acetic acid
|
| Molecular Formula |
C26H25N3O6
|
| Molecular Weight |
475.5
|
| Smiles |
O=C(O)CC1CC(CNC(=O)c2cc(NC(=O)OCC3c4ccccc4-c4ccccc43)on2)C1
|
O=C(O)CC1CC(CNC(=O)c2cc(NC(=O)OCC3c4ccccc4-c4ccccc43)on2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.