| Name |
7-[(benzyloxy)carbonyl]-3-(trifluoromethyl)-5H,6H,7H,8H-imidazo[1,5-a]pyrazine-1-carboxylic acid
|
| Molecular Formula |
C16H14F3N3O4
|
| Molecular Weight |
369.29
|
| Smiles |
O=C(O)c1nc(C(F)(F)F)n2c1CN(C(=O)OCc1ccccc1)CC2
|
O=C(O)c1nc(C(F)(F)F)n2c1CN(C(=O)OCc1ccccc1)CC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.