| Name |
(9H-Fluoren-9-yl)methyl tert-butyl (6-oxohexane-1,5-diyl)dicarbamate
|
| Molecular Formula |
C26H32N2O5
|
| Molecular Weight |
452.5
|
| Smiles |
CC(C)(C)OC(=O)NC(C=O)CCCCNC(=O)OCC1c2ccccc2-c2ccccc21
|
CC(C)(C)OC(=O)NC(C=O)CCCCNC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.