| Name |
rel-(R)-4-((S)-1,2-Dibromoethyl)-2,2-bis(trifluoromethyl)-1,3-dioxolane
|
| Molecular Formula |
C7H6Br2F6O2
|
| Molecular Weight |
395.92
|
| Smiles |
FC(F)(F)C1(C(F)(F)F)OCC(C(Br)CBr)O1
|
FC(F)(F)C1(C(F)(F)F)OCC(C(Br)CBr)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.