| Name |
7H-Furo[2,3-f][1]benzopyran-3,7(2H)-dione, 2-[(2,3-dimethoxyphenyl)methylene]-8,9-dihydro-9-phenyl-
|
| Molecular Formula |
C26H20O6
|
| Molecular Weight |
428.4
|
| Smiles |
COc1cccc(C=C2Oc3c(ccc4c3C(c3ccccc3)CC(=O)O4)C2=O)c1OC
|
COc1cccc(C=C2Oc3c(ccc4c3C(c3ccccc3)CC(=O)O4)C2=O)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.