| Name |
1-(3-Aminopentan-3-yl)-4,4-dimethylcycloheptan-1-ol
|
| Molecular Formula |
C14H29NO
|
| Molecular Weight |
227.39
|
| Smiles |
CCC(N)(CC)C1(O)CCCC(C)(C)CC1
|
CCC(N)(CC)C1(O)CCCC(C)(C)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.