| Name |
(3R)-3-(5-bromo-1,3-thiazol-2-yl)-3-{[(tert-butoxy)carbonyl]amino}propanoic acid
|
| Molecular Formula |
C11H15BrN2O4S
|
| Molecular Weight |
351.22
|
| Smiles |
CC(C)(C)OC(=O)NC(CC(=O)O)c1ncc(Br)s1
|
CC(C)(C)OC(=O)NC(CC(=O)O)c1ncc(Br)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.