| Name |
3-(3-Chloro-2,4-difluorophenyl)-4,4,4-trifluorobutanoic acid
|
| Molecular Formula |
C10H6ClF5O2
|
| Molecular Weight |
288.60
|
| Smiles |
O=C(O)CC(c1ccc(F)c(Cl)c1F)C(F)(F)F
|
O=C(O)CC(c1ccc(F)c(Cl)c1F)C(F)(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.