| Name |
5-{[(2S)-3-(dimethylamino)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]methyl}oxolane-2-carboxylic acid
|
| Molecular Formula |
C26H31N3O6
|
| Molecular Weight |
481.5
|
| Smiles |
CN(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC1CCC(C(=O)O)O1
|
CN(C)CC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)NCC1CCC(C(=O)O)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.