| Name |
8-methyl-2-({3-oxo-2H,3H-[1,2,4]triazolo[4,3-a]pyridin-2-yl}methyl)-4H-pyrido[1,2-a]pyrimidin-4-one
|
| Molecular Formula |
C16H13N5O2
|
| Molecular Weight |
307.31
|
| Smiles |
Cc1ccn2c(=O)cc(Cn3nc4ccccn4c3=O)nc2c1
|
Cc1ccn2c(=O)cc(Cn3nc4ccccn4c3=O)nc2c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.