| Name |
N-ethyl-2-(4-{[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]methyl}piperazin-1-yl)pyrimidin-4-amine
|
| Molecular Formula |
C14H18F3N7O
|
| Molecular Weight |
357.33
|
| Smiles |
CCNc1ccnc(N2CCN(Cc3nnc(C(F)(F)F)o3)CC2)n1
|
CCNc1ccnc(N2CCN(Cc3nnc(C(F)(F)F)o3)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.