| Name |
[4-(5-bromopyridin-3-yl)-1H-1,2,3-triazol-1-yl]methyl 2,2-dimethylpropanoate
|
| Molecular Formula |
C13H15BrN4O2
|
| Molecular Weight |
339.19
|
| Smiles |
CC(C)(C)C(=O)OCn1cc(-c2cncc(Br)c2)nn1
|
CC(C)(C)C(=O)OCn1cc(-c2cncc(Br)c2)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.