| Name |
4-(4-(2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)piperazine-1-carbonyl)benzoic acid
|
| Molecular Formula |
C25H22N4O7
|
| Molecular Weight |
490.5
|
| Smiles |
O=C1CCC(N2C(=O)c3cccc(N4CCN(C(=O)c5ccc(C(=O)O)cc5)CC4)c3C2=O)C(=O)N1
|
O=C1CCC(N2C(=O)c3cccc(N4CCN(C(=O)c5ccc(C(=O)O)cc5)CC4)c3C2=O)C(=O)N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.