| Name |
1-phenyl-1H-1,2,4-triazole-5-sulfonamide
|
| Molecular Formula |
C8H8N4O2S
|
| Molecular Weight |
224.24
|
| Smiles |
NS(=O)(=O)c1ncnn1-c1ccccc1
|
NS(=O)(=O)c1ncnn1-c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.