| Name |
rac-(2R,3S)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}-5-oxo-3-phenyl-4-(propan-2-yl)piperazine-2-carboxylic acid
|
| Molecular Formula |
C29H28N2O5
|
| Molecular Weight |
484.5
|
| Smiles |
CC(C)N1C(=O)CN(C(=O)OCC2c3ccccc3-c3ccccc32)C(C(=O)O)C1c1ccccc1
|
CC(C)N1C(=O)CN(C(=O)OCC2c3ccccc3-c3ccccc32)C(C(=O)O)C1c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.