| Name |
(1RS,3SR)-3-{[(2S)-3-cyclopropyl-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanamido]methyl}-2,2-difluorocyclopropane-1-carboxylic acid
|
| Molecular Formula |
C26H26F2N2O5
|
| Molecular Weight |
484.5
|
| Smiles |
O=C(NC(CC1CC1)C(=O)NCC1C(C(=O)O)C1(F)F)OCC1c2ccccc2-c2ccccc21
|
O=C(NC(CC1CC1)C(=O)NCC1C(C(=O)O)C1(F)F)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.