| Name |
1-(4-methoxyphenyl)-3-(1H-1,2,4-triazol-1-yl)-1,2-dihydropyrazin-2-one
|
| Molecular Formula |
C13H11N5O2
|
| Molecular Weight |
269.26
|
| Smiles |
COc1ccc(-n2ccnc(-n3cncn3)c2=O)cc1
|
COc1ccc(-n2ccnc(-n3cncn3)c2=O)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.