| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl 3',4'-dihydro-2'H-spiro[cyclopropane-1,1'-naphthalene]-3-carboxylate
|
| Molecular Formula |
C21H17NO4
|
| Molecular Weight |
347.4
|
| Smiles |
O=C(ON1C(=O)c2ccccc2C1=O)C1CC12CCCc1ccccc12
|
O=C(ON1C(=O)c2ccccc2C1=O)C1CC12CCCc1ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.