| Name |
(3R)-3-({2-[1-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)ethyl]-1,3-thiazol-4-yl}formamido)pentanoic acid
|
| Molecular Formula |
C26H27N3O5S
|
| Molecular Weight |
493.6
|
| Smiles |
CCC(CC(=O)O)NC(=O)c1csc(C(C)NC(=O)OCC2c3ccccc3-c3ccccc32)n1
|
CCC(CC(=O)O)NC(=O)c1csc(C(C)NC(=O)OCC2c3ccccc3-c3ccccc32)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.