| Name |
N,N'''-1,2-Ethanediylbis[N'-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine]
|
| Molecular Formula |
C16H14Cl2N10S2
|
| Molecular Weight |
481.4
|
| Smiles |
NC(=NCCN=C(N)Nc1c(Cl)ccc2nsnc12)Nc1c(Cl)ccc2nsnc12
|
NC(=NCCN=C(N)Nc1c(Cl)ccc2nsnc12)Nc1c(Cl)ccc2nsnc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.