| Name |
methyl 1-methyl-1H,4H,5H,6H-pyrrolo[3,4-c]pyrazole-3-carboxylate hydrochloride
|
| Molecular Formula |
C8H12ClN3O2
|
| Molecular Weight |
217.65
|
| Smiles |
COC(=O)c1nn(C)c2c1CNC2.Cl
|
COC(=O)c1nn(C)c2c1CNC2.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.