| Name |
rac-tert-butyl N-{1-[(1R,3R)-3-(aminomethyl)-2,2-dimethylcyclopropyl]cyclohexyl}carbamate
|
| Molecular Formula |
C17H32N2O2
|
| Molecular Weight |
296.4
|
| Smiles |
CC(C)(C)OC(=O)NC1(C2C(CN)C2(C)C)CCCCC1
|
CC(C)(C)OC(=O)NC1(C2C(CN)C2(C)C)CCCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.