| Name |
N-(2-((2'-Benzhydryl-7'-bromo-1H,1'H-[3,3'-biindol]-2-yl)methyl)phenyl)acetamide
|
| Molecular Formula |
C38H30BrN3O
|
| Molecular Weight |
624.6
|
| Smiles |
CC(=O)Nc1ccccc1Cc1[nH]c2ccccc2c1-c1c(C(c2ccccc2)c2ccccc2)[nH]c2c(Br)cccc12
|
CC(=O)Nc1ccccc1Cc1[nH]c2ccccc2c1-c1c(C(c2ccccc2)c2ccccc2)[nH]c2c(Br)cccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.