| Name |
(1S,2R,5S)-2-Isopropyl-5-methylcyclohexyl ((S)-6,6,12-triphenyl-5,6,7,12-tetrahydroindolo[2,3-b]carbazol-2-yl) carbonate
|
| Molecular Formula |
C47H44N2O3
|
| Molecular Weight |
684.9
|
| Smiles |
CC1CCC(C(C)C)C(OC(=O)Oc2ccc3[nH]c4c(c3c2)C(c2ccccc2)c2c([nH]c3ccccc23)C4(c2ccccc2)c2ccccc2)C1
|
CC1CCC(C(C)C)C(OC(=O)Oc2ccc3[nH]c4c(c3c2)C(c2ccccc2)c2c([nH]c3ccccc23)C4(c2ccccc2)c2ccccc2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.