| Name |
tert-Butyl N-{3-[(3aR,8aR)-8-(2-butoxy-5-{[(tert-butoxy)carbonyl]amino}phenyl)-2H,3H,3aH,8H,8aH-furo[2,3-b]indol-3a-yl]-4-butoxyphenyl}carbamate
|
| Molecular Formula |
C40H53N3O7
|
| Molecular Weight |
687.9
|
| Smiles |
CCCCOc1ccc(NC(=O)OC(C)(C)C)cc1N1c2ccccc2C2(c3cc(NC(=O)OC(C)(C)C)ccc3OCCCC)CCOC12
|
CCCCOc1ccc(NC(=O)OC(C)(C)C)cc1N1c2ccccc2C2(c3cc(NC(=O)OC(C)(C)C)ccc3OCCCC)CCOC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.