| Name |
9'-(2-(Bis(4-(tert-butyl)phenyl)methyl)-1H-indol-3-yl)-1'-phenylspiro[isoindoline-1,3'-pyrrolo[1,2-a]indol]-3-one
|
| Molecular Formula |
C53H47N3O
|
| Molecular Weight |
742.0
|
| Smiles |
CC(C)(C)c1ccc(C(c2ccc(C(C)(C)C)cc2)c2[nH]c3ccccc3c2-c2c3n(c4ccccc24)C2(C=C3c3ccccc3)NC(=O)c3ccccc32)cc1
|
CC(C)(C)c1ccc(C(c2ccc(C(C)(C)C)cc2)c2[nH]c3ccccc3c2-c2c3n(c4ccccc24)C2(C=C3c3ccccc3)NC(=O)c3ccccc32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.