| Name |
3-Isopropyl 3'-methyl 2,2'-dimethyl-5'-(naphthalen-2-yl)-5-phenyl-[1,1'-bipyrrole]-3,3'-dicarboxylate
|
| Molecular Formula |
C32H30N2O4
|
| Molecular Weight |
506.6
|
| Smiles |
COC(=O)c1cc(-c2ccc3ccccc3c2)n(-n2c(-c3ccccc3)cc(C(=O)OC(C)C)c2C)c1C
|
COC(=O)c1cc(-c2ccc3ccccc3c2)n(-n2c(-c3ccccc3)cc(C(=O)OC(C)C)c2C)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.