| Name |
Dimethyl 5-(4-chlorophenyl)-2,2'-dimethyl-5'-(naphthalen-2-yl)-[1,1'-bipyrrole]-3,3'-dicarboxylate
|
| Molecular Formula |
C30H25ClN2O4
|
| Molecular Weight |
513.0
|
| Smiles |
COC(=O)c1cc(-c2ccc(Cl)cc2)n(-n2c(-c3ccc4ccccc4c3)cc(C(=O)OC)c2C)c1C
|
COC(=O)c1cc(-c2ccc(Cl)cc2)n(-n2c(-c3ccc4ccccc4c3)cc(C(=O)OC)c2C)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.