| Name |
9-(2,5-Dimethoxyphenyl)-1,3,7-trimethyl-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione
|
| Molecular Formula |
C19H24N5O4+
|
| Molecular Weight |
386.4
|
| Smiles |
COc1ccc(OC)c(N2CC(C)C[N+]3=C2N=C2C3C(=O)N(C)C(=O)N2C)c1
|
COc1ccc(OC)c(N2CC(C)C[N+]3=C2N=C2C3C(=O)N(C)C(=O)N2C)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.