| Name |
2-[3,9-dimethyl-6,8-dioxo-7-[(E)-3-phenylprop-2-enyl]-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazin-1-yl]acetamide
|
| Molecular Formula |
C20H25N7O3
|
| Molecular Weight |
411.5
|
| Smiles |
CC1=NN(CC(N)=O)C2NC3C(C(=O)N(CC=Cc4ccccc4)C(=O)N3C)N2C1
|
CC1=NN(CC(N)=O)C2NC3C(C(=O)N(CC=Cc4ccccc4)C(=O)N3C)N2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.