| Name |
tert-butyl N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-N-[4-[[2-(2,6-dioxo-3-piperidyl)-1,3-dioxo-isoindolin-4-yl]amino]-4-oxo-butyl]carbamate
|
| Molecular Formula |
C30H43N5O10
|
| Molecular Weight |
633.7
|
| Smiles |
CC(C)(C)OC(=O)N(CCCC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)CCOCCOCCOCCN
|
CC(C)(C)OC(=O)N(CCCC(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O)CCOCCOCCOCCN
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.