| Name |
3-Piperidinecarboxylic acid, 5,5-difluoro-1-(2,2,2-trifluoroacetyl)-, ethyl ester
|
| Molecular Formula |
C10H12F5NO3
|
| Molecular Weight |
289.20
|
| Smiles |
CCOC(=O)C1CN(C(=O)C(F)(F)F)CC(F)(F)C1
|
CCOC(=O)C1CN(C(=O)C(F)(F)F)CC(F)(F)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.