| Name |
2-{8-Bromo-[1,2,4]triazolo[4,3-a]pyrazin-3-yl}propan-2-ol
|
| Molecular Formula |
C8H9BrN4O
|
| Molecular Weight |
257.09
|
| Smiles |
CC(C)(O)c1nnc2c(Br)nccn12
|
CC(C)(O)c1nnc2c(Br)nccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.