| Name |
2-{5-ethyl-1-[(4-fluorophenyl)methyl]-1H-1,2,3-triazol-4-yl}ethan-1-amine
|
| Molecular Formula |
C13H17FN4
|
| Molecular Weight |
248.30
|
| Smiles |
CCc1c(CCN)nnn1Cc1ccc(F)cc1
|
CCc1c(CCN)nnn1Cc1ccc(F)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.