| Name |
5-(1,2-oxazol-4-yl)-4-(2,2,2-trifluoroethyl)-4H-1,2,4-triazole-3-thiol
|
| Molecular Formula |
C7H5F3N4OS
|
| Molecular Weight |
250.20
|
| Smiles |
FC(F)(F)Cn1c(-c2cnoc2)n[nH]c1=S
|
FC(F)(F)Cn1c(-c2cnoc2)n[nH]c1=S
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.