| Name |
(3S,4R,5R,6S,8E,10E)a11aCarbamoyla3,5adimethyla6a{[tris(propana2ayl)silyl]oxy}undecaa8,10adiena4ayl (2E)a3aphenylpropa2aenoate
|
| Molecular Formula |
C32H51NO4Si
|
| Molecular Weight |
541.8
|
| Smiles |
CCC(C)C(OC(=O)C=Cc1ccccc1)C(C)C(CC=CC=CC(N)=O)O[Si](C(C)C)(C(C)C)C(C)C
|
CCC(C)C(OC(=O)C=Cc1ccccc1)C(C)C(CC=CC=CC(N)=O)O[Si](C(C)C)(C(C)C)C(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.