| Name |
(3aR,6aR)-6a-Chloro-6,6-dimethyl-2,5-diphenyl-3a-(p-tolyl)-3a,6a-dihydro-6H-furo[3,2-b]pyrrole
|
| Molecular Formula |
C27H24ClNO
|
| Molecular Weight |
413.9
|
| Smiles |
Cc1ccc(C23C=C(c4ccccc4)OC2(Cl)C(C)(C)C(c2ccccc2)=N3)cc1
|
Cc1ccc(C23C=C(c4ccccc4)OC2(Cl)C(C)(C)C(c2ccccc2)=N3)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.