| Name |
2-({[1-benzyl-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)pyrrolidin-3-yl]formamido}oxy)-3-methoxypropanoic acid
|
| Molecular Formula |
C31H33N3O7
|
| Molecular Weight |
559.6
|
| Smiles |
COCC(ONC(=O)C1(NC(=O)OCC2c3ccccc3-c3ccccc32)CCN(Cc2ccccc2)C1)C(=O)O
|
COCC(ONC(=O)C1(NC(=O)OCC2c3ccccc3-c3ccccc32)CCN(Cc2ccccc2)C1)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.