| Name |
3-{2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]-1,3-thiazole-4-amido}cyclobutane-1-carboxylic acid
|
| Molecular Formula |
C25H23N3O5S
|
| Molecular Weight |
477.5
|
| Smiles |
O=C(NCc1nc(C(=O)NC2CC(C(=O)O)C2)cs1)OCC1c2ccccc2-c2ccccc21
|
O=C(NCc1nc(C(=O)NC2CC(C(=O)O)C2)cs1)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.